About [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate
[3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate (PubChem CID 122626645) has the molecular formula C20H23N3O3
and a molecular weight of 353.42 g/mol. Its IUPAC name is [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate.
Molecular Properties
| Compound Name | [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate |
| PubChem CID | 122626645 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate |
| SMILES | CCc1ccc(OCc2c(CC)cccc2OC(=O)CCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-3-15-8-10-17(11-9-15)25-14-18-16(4-2)6-5-7-19(18)26-20(24)12-13-22-23-21/h5-11H,3-4,12-14H2,1-2H3 |
| InChIKey | FNFMBHSSYZPDQO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate?
The IUPAC name of [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate (CID 122626645) is [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate.
What is the SMILES notation for [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate?
The canonical SMILES for [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate is CCc1ccc(OCc2c(CC)cccc2OC(=O)CCN=[N+]=[N-])cc1.
What is the InChIKey of [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate?
The InChIKey is FNFMBHSSYZPDQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O3/c1-3-15-8-10-17(11-9-15)25-14-18-16(4-2)6-5-7-19(18)26-20(24)12-13-22-23-21/h5-11H,3-4,12-14H2,1-2H3.
What are the key properties of [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate?
[3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate has a molecular weight of 353.42 g/mol, XLogP of 5.00, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-ethyl-2-[(4-ethylphenoxy)methyl]phenyl] 3-azidopropanoate is sourced from PubChem (CID 122626645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).