C20H22O4 — CID 122649926
[3-cyclopropyl-2-[(4-ethylphenoxy)methyl]phenyl] methyl carbonate (PubChem CID 122649926) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is [3-cyclopropyl-2-[(4-ethylphenoxy)methyl]phenyl] methyl carbonate.
| Compound Name | [3-cyclopropyl-2-[(4-ethylphenoxy)methyl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 122649926 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [3-cyclopropyl-2-[(4-ethylphenoxy)methyl]phenyl] methyl carbonate |
| SMILES | CCc1ccc(OCc2c(OC(=O)OC)cccc2C2CC2)cc1 |
| InChI | InChI=1S/C20H22O4/c1-3-14-7-11-16(12-8-14)23-13-18-17(15-9-10-15)5-4-6-19(18)24-20(21)22-2/h4-8,11-12,15H,3,9-10,13H2,1-2H3 |
| InChIKey | ATWVZRGUYFBSIZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|