C21H16N2O4S — CID 1226415
5-[C-methyl-N-(9H-xanthene-9-carbonylamino)carbonimidoyl]thiophene-2-carboxylic acid (PubChem CID 1226415) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 5-[C-methyl-N-(9H-xanthene-9-carbonylamino)carbonimidoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[C-methyl-N-(9H-xanthene-9-carbonylamino)carbonimidoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 1226415 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 5-[C-methyl-N-(9H-xanthene-9-carbonylamino)carbonimidoyl]thiophene-2-carboxylic acid |
| SMILES | CC(=NNC(=O)C1c2ccccc2Oc2ccccc21)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C21H16N2O4S/c1-12(17-10-11-18(28-17)21(25)26)22-23-20(24)19-13-6-2-4-8-15(13)27-16-9-5-3-7-14(16)19/h2-11,19H,1H3,(H,23,24)(H,25,26) |
| InChIKey | XZOJIFXSVICLNI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|