C24H24ClF8NO2S — CID 122669148
9b-(4-fluoro-3-propan-2-ylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride (PubChem CID 122669148) has the molecular formula C24H24ClF8NO2S and a molecular weight of 577.97 g/mol. Its IUPAC name is 9b-(4-fluoro-3-propan-2-ylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride.
| Compound Name | 9b-(4-fluoro-3-propan-2-ylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride |
|---|---|
| PubChem CID | 122669148 |
| Molecular Formula | C24H24ClF8NO2S |
| Molecular Weight | 577.97 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | 9b-(4-fluoro-3-propan-2-ylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole;hydrochloride |
| SMILES | CC(C)c1cc(S(=O)(=O)C23CCNC2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)ccc1F.Cl |
| InChI | InChI=1S/C24H23F8NO2S.ClH/c1-13(2)17-12-16(5-7-19(17)25)36(34,35)21-9-10-33-20(21)8-3-14-11-15(4-6-18(14)21)22(26,23(27,28)29)24(30,31)32;/h4-7,11-13,20,33H,3,8-10H2,1-2H3;1H |
| InChIKey | XXLAVWMIIFFGLR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.97 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |