C25H35N9O7 — CID 122675542
[12-[2-(2-azidoethoxy)ethyl]-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl] N-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethyl]carbamate (PubChem CID 122675542) has the molecular formula C25H35N9O7 and a molecular weight of 573.61 g/mol. Its IUPAC name is [12-[2-(2-azidoethoxy)ethyl]-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl] N-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethyl]carbamate.
| Compound Name | [12-[2-(2-azidoethoxy)ethyl]-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl] N-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 122675542 |
| Molecular Formula | C25H35N9O7 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | [12-[2-(2-azidoethoxy)ethyl]-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl] N-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethyl]carbamate |
| SMILES | [N-]=[N+]=NCCOCCn1nnc2c1CCC1C(CC2)C1OC(=O)NCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C25H35N9O7/c26-31-29-10-15-40-16-12-34-20-4-2-18-17(1-3-19(20)30-32-34)24(18)41-25(38)28-9-14-39-13-8-27-21(35)7-11-33-22(36)5-6-23(33)37/h5-6,17-18,24H,1-4,7-16H2,(H,27,35)(H,28,38) |
| InChIKey | UBLYHYNYDSQQOQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 202.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|