C16H12BrFO2S — CID 122675896
7-bromo-4-(3-fluorophenyl)sulfonyl-1,2-dihydronaphthalene (PubChem CID 122675896) has the molecular formula C16H12BrFO2S and a molecular weight of 367.24 g/mol. Its IUPAC name is 7-bromo-4-(3-fluorophenyl)sulfonyl-1,2-dihydronaphthalene.
| Compound Name | 7-bromo-4-(3-fluorophenyl)sulfonyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 122675896 |
| Molecular Formula | C16H12BrFO2S |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 7-bromo-4-(3-fluorophenyl)sulfonyl-1,2-dihydronaphthalene |
| SMILES | O=S(=O)(C1=CCCc2cc(Br)ccc21)c1cccc(F)c1 |
| InChI | InChI=1S/C16H12BrFO2S/c17-12-7-8-15-11(9-12)3-1-6-16(15)21(19,20)14-5-2-4-13(18)10-14/h2,4-10H,1,3H2 |
| InChIKey | YWUVWCUCCXFHPU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |