C31H31F7N2O4S — CID 122680732
[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-pyridin-2-ylsulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(1-hydroxyethenyl)-1-bicyclo[2.2.2]octanyl]methanone (PubChem CID 122680732) has the molecular formula C31H31F7N2O4S and a molecular weight of 660.65 g/mol. Its IUPAC name is [7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-pyridin-2-ylsulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(1-hydroxyethenyl)-1-bicyclo[2.2.2]octanyl]methanone.
| Compound Name | [7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-pyridin-2-ylsulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(1-hydroxyethenyl)-1-bicyclo[2.2.2]octanyl]methanone |
|---|---|
| PubChem CID | 122680732 |
| Molecular Formula | C31H31F7N2O4S |
| Molecular Weight | 660.65 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | [7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-pyridin-2-ylsulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(1-hydroxyethenyl)-1-bicyclo[2.2.2]octanyl]methanone |
| SMILES | C=C(O)C12CCC(C(=O)N3CCC4(S(=O)(=O)c5ccccn5)c5ccc(C(F)(C(F)(F)F)C(F)(F)F)cc5CCC34)(CC1)CC2 |
| InChI | InChI=1S/C31H31F7N2O4S/c1-19(41)26-9-12-27(13-10-26,14-11-26)25(42)40-17-15-28(45(43,44)24-4-2-3-16-39-24)22-7-6-21(18-20(22)5-8-23(28)40)29(32,30(33,34)35)31(36,37)38/h2-4,6-7,16,18,23,41H,1,5,8-15,17H2 |
| InChIKey | WMLCKFNDYKJOBL-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|