C24H33NO3 — CID 122691789
(E)-3-[3-[1-[(7-ethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-methyl-1-oxopropan-2-yl]phenyl]prop-2-enoic acid (PubChem CID 122691789) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is (E)-3-[3-[1-[(7-ethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-methyl-1-oxopropan-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[1-[(7-ethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-methyl-1-oxopropan-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 122691789 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (E)-3-[3-[1-[(7-ethyl-2-bicyclo[3.3.1]nonanyl)amino]-2-methyl-1-oxopropan-2-yl]phenyl]prop-2-enoic acid |
| SMILES | CCC1CC2CCC(NC(=O)C(C)(C)c3cccc(/C=C/C(=O)O)c3)C(C1)C2 |
| InChI | InChI=1S/C24H33NO3/c1-4-16-12-18-8-10-21(19(13-16)14-18)25-23(28)24(2,3)20-7-5-6-17(15-20)9-11-22(26)27/h5-7,9,11,15-16,18-19,21H,4,8,10,12-14H2,1-3H3,(H,25,28)(H,26,27)/b11-9+ |
| InChIKey | ZLPQTBMBCGZZBU-PKNBQFBNSA-N |
| XLogP | 4.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|