C27H39NO — CID 142912166
2-methyl-N-(3-methyl-2-bicyclo[3.3.1]nonanyl)-2-[3-[(E)-3-methylidenehex-1-enyl]phenyl]propanamide (PubChem CID 142912166) has the molecular formula C27H39NO and a molecular weight of 393.62 g/mol. Its IUPAC name is 2-methyl-N-(3-methyl-2-bicyclo[3.3.1]nonanyl)-2-[3-[(E)-3-methylidenehex-1-enyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-(3-methyl-2-bicyclo[3.3.1]nonanyl)-2-[3-[(E)-3-methylidenehex-1-enyl]phenyl]propanamide |
|---|---|
| PubChem CID | 142912166 |
| Molecular Formula | C27H39NO |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | 2-methyl-N-(3-methyl-2-bicyclo[3.3.1]nonanyl)-2-[3-[(E)-3-methylidenehex-1-enyl]phenyl]propanamide |
| SMILES | C=C(/C=C/c1cccc(C(C)(C)C(=O)NC2C(C)CC3CCCC2C3)c1)CCC |
| InChI | InChI=1S/C27H39NO/c1-6-9-19(2)14-15-21-10-8-13-24(18-21)27(4,5)26(29)28-25-20(3)16-22-11-7-12-23(25)17-22/h8,10,13-15,18,20,22-23,25H,2,6-7,9,11-12,16-17H2,1,3-5H3,(H,28,29)/b15-14+ |
| InChIKey | OIEWXQAFSZSZTQ-CCEZHUSRSA-N |
| XLogP | 6.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|