C11H23NOS — CID 122692152
1-imino-4,4,6,6-tetramethylthiocane 1-oxide (PubChem CID 122692152) has the molecular formula C11H23NOS and a molecular weight of 217.38 g/mol. Its IUPAC name is 1-imino-4,4,6,6-tetramethylthiocane 1-oxide.
| Compound Name | 1-imino-4,4,6,6-tetramethylthiocane 1-oxide |
|---|---|
| PubChem CID | 122692152 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-imino-4,4,6,6-tetramethylthiocane 1-oxide |
| SMILES | [H]N=S1(=O)CCC(C)(C)CC(C)(C)CC1 |
| InChI | InChI=1S/C11H23NOS/c1-10(2)5-7-14(12,13)8-6-11(3,4)9-10/h12H,5-9H2,1-4H3 |
| InChIKey | NOQMEZSKBUAOOH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |