C12H26N2O2S — CID 163907474
1-(2,5,5,7-tetramethyl-1,1-dioxothiazocan-7-yl)ethanamine (PubChem CID 163907474) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-(2,5,5,7-tetramethyl-1,1-dioxothiazocan-7-yl)ethanamine.
| Compound Name | 1-(2,5,5,7-tetramethyl-1,1-dioxothiazocan-7-yl)ethanamine |
|---|---|
| PubChem CID | 163907474 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(2,5,5,7-tetramethyl-1,1-dioxothiazocan-7-yl)ethanamine |
| SMILES | CC(N)C1(C)CC(C)(C)CCN(C)S(=O)(=O)C1 |
| InChI | InChI=1S/C12H26N2O2S/c1-10(13)12(4)8-11(2,3)6-7-14(5)17(15,16)9-12/h10H,6-9,13H2,1-5H3 |
| InChIKey | QPFLOUSUCALYMK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |