C20H39O2P — CID 122692615
9-tert-butyl-8,8,10,10-tetraethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane (PubChem CID 122692615) has the molecular formula C20H39O2P and a molecular weight of 342.50 g/mol. Its IUPAC name is 9-tert-butyl-8,8,10,10-tetraethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane.
| Compound Name | 9-tert-butyl-8,8,10,10-tetraethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 122692615 |
| Molecular Formula | C20H39O2P |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 9-tert-butyl-8,8,10,10-tetraethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
| SMILES | CCC1(CC)CC2(CC(CC)(CC)P1C(C)(C)C)OCCCO2 |
| InChI | InChI=1S/C20H39O2P/c1-8-18(9-2)15-20(21-13-12-14-22-20)16-19(10-3,11-4)23(18)17(5,6)7/h8-16H2,1-7H3 |
| InChIKey | ZHDWHKZNZNLLJL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|