C22H43O2P — CID 58051254
9-tert-butyl-8,8,10,10-tetraethyl-7,11-dimethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane (PubChem CID 58051254) has the molecular formula C22H43O2P and a molecular weight of 370.56 g/mol. Its IUPAC name is 9-tert-butyl-8,8,10,10-tetraethyl-7,11-dimethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane.
| Compound Name | 9-tert-butyl-8,8,10,10-tetraethyl-7,11-dimethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 58051254 |
| Molecular Formula | C22H43O2P |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | 9-tert-butyl-8,8,10,10-tetraethyl-7,11-dimethyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
| SMILES | CCC1(CC)C(C)C2(OCCCO2)C(C)C(CC)(CC)P1C(C)(C)C |
| InChI | InChI=1S/C22H43O2P/c1-10-20(11-2)17(5)22(23-15-14-16-24-22)18(6)21(12-3,13-4)25(20)19(7,8)9/h17-18H,10-16H2,1-9H3 |
| InChIKey | BXFFWAWGVCNRQB-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|