C18H35O2P — CID 122695409
8,8,10-triethyl-9-methyl-10-propyl-1,5-dioxa-9-phosphaspiro[5.5]undecane (PubChem CID 122695409) has the molecular formula C18H35O2P and a molecular weight of 314.45 g/mol. Its IUPAC name is 8,8,10-triethyl-9-methyl-10-propyl-1,5-dioxa-9-phosphaspiro[5.5]undecane.
| Compound Name | 8,8,10-triethyl-9-methyl-10-propyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 122695409 |
| Molecular Formula | C18H35O2P |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 8,8,10-triethyl-9-methyl-10-propyl-1,5-dioxa-9-phosphaspiro[5.5]undecane |
| SMILES | CCCC1(CC)CC2(CC(CC)(CC)P1C)OCCCO2 |
| InChI | InChI=1S/C18H35O2P/c1-6-11-17(9-4)15-18(19-12-10-13-20-18)14-16(7-2,8-3)21(17)5/h6-15H2,1-5H3 |
| InChIKey | UCLBRKVIAVZTSU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|