C6H9N3O2 — CID 122695718
N-methyl-2-(methylamino)-1,3-oxazole-5-carboxamide (PubChem CID 122695718) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is N-methyl-2-(methylamino)-1,3-oxazole-5-carboxamide.
| Compound Name | N-methyl-2-(methylamino)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 122695718 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-methyl-2-(methylamino)-1,3-oxazole-5-carboxamide |
| SMILES | CNC(=O)c1cnc(NC)o1 |
| InChI | InChI=1S/C6H9N3O2/c1-7-5(10)4-3-9-6(8-2)11-4/h3H,1-2H3,(H,7,10)(H,8,9) |
| InChIKey | GEEMWYGZLYTCLD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |