C5H7N3O2 — CID 169249960
5-(methylamino)-1,3-oxazole-2-carboxamide (PubChem CID 169249960) has the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. Its IUPAC name is 5-(methylamino)-1,3-oxazole-2-carboxamide.
| Compound Name | 5-(methylamino)-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 169249960 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 5-(methylamino)-1,3-oxazole-2-carboxamide |
| SMILES | CNc1cnc(C(N)=O)o1 |
| InChI | InChI=1S/C5H7N3O2/c1-7-3-2-8-5(10-3)4(6)9/h2,7H,1H3,(H2,6,9) |
| InChIKey | OWCNRSZWILIMHG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |