C12H21N3O2 — CID 122693179
N-tert-butyl-2-(tert-butylamino)-1,3-oxazole-5-carboxamide (PubChem CID 122693179) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-tert-butyl-2-(tert-butylamino)-1,3-oxazole-5-carboxamide.
| Compound Name | N-tert-butyl-2-(tert-butylamino)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 122693179 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N-tert-butyl-2-(tert-butylamino)-1,3-oxazole-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cnc(NC(C)(C)C)o1 |
| InChI | InChI=1S/C12H21N3O2/c1-11(2,3)14-9(16)8-7-13-10(17-8)15-12(4,5)6/h7H,1-6H3,(H,13,15)(H,14,16) |
| InChIKey | GNQPXDIXNUEIHO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |