C25H22N4O4 — CID 122714867
N-(2-imidazol-1-ylethyl)-2-[[(2Z)-2-[(1-methylindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide (PubChem CID 122714867) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-(2-imidazol-1-ylethyl)-2-[[(2Z)-2-[(1-methylindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide.
| Compound Name | N-(2-imidazol-1-ylethyl)-2-[[(2Z)-2-[(1-methylindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 122714867 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-(2-imidazol-1-ylethyl)-2-[[(2Z)-2-[(1-methylindol-3-yl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetamide |
| SMILES | Cn1cc(/C=C2\Oc3cc(OCC(=O)NCCn4ccnc4)ccc3C2=O)c2ccccc21 |
| InChI | InChI=1S/C25H22N4O4/c1-28-14-17(19-4-2-3-5-21(19)28)12-23-25(31)20-7-6-18(13-22(20)33-23)32-15-24(30)27-9-11-29-10-8-26-16-29/h2-8,10,12-14,16H,9,11,15H2,1H3,(H,27,30)/b23-12- |
| InChIKey | LPMCSQHFAGGKGR-FMCGGJTJSA-N |
| XLogP | 3.19 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|