C10H18N2O — CID 123139611
N-[3-(dimethylamino)hepta-3,5-dienyl]formamide (PubChem CID 123139611) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is N-[3-(dimethylamino)hepta-3,5-dienyl]formamide.
| Compound Name | N-[3-(dimethylamino)hepta-3,5-dienyl]formamide |
|---|---|
| PubChem CID | 123139611 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-[3-(dimethylamino)hepta-3,5-dienyl]formamide |
| SMILES | CC=CC=C(CCNC=O)N(C)C |
| InChI | InChI=1S/C10H18N2O/c1-4-5-6-10(12(2)3)7-8-11-9-13/h4-6,9H,7-8H2,1-3H3,(H,11,13) |
| InChIKey | UKTRXQAKZJAYTH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|