C21H38N4O5S — CID 123140740
bis[2-(diethylamino)ethyl] 2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate (PubChem CID 123140740) has the molecular formula C21H38N4O5S and a molecular weight of 458.63 g/mol. Its IUPAC name is bis[2-(diethylamino)ethyl] 2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate.
| Compound Name | bis[2-(diethylamino)ethyl] 2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 123140740 |
| Molecular Formula | C21H38N4O5S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | bis[2-(diethylamino)ethyl] 2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
| SMILES | CCN(CC)CCOC(=O)C1NC(=O)N2C1SC(C)(C)C2C(=O)OCCN(CC)CC |
| InChI | InChI=1S/C21H38N4O5S/c1-7-23(8-2)11-13-29-18(26)15-17-25(20(28)22-15)16(21(5,6)31-17)19(27)30-14-12-24(9-3)10-4/h15-17H,7-14H2,1-6H3,(H,22,28) |
| InChIKey | VLIIAAPKSQULOD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |