C22H28F3N3O2S — CID 123144875
1-(2-ethylcyclopropyl)-N-[3-[[7-(trifluoromethyl)quinolin-4-yl]amino]propyl]but-1-ene-1-sulfonamide (PubChem CID 123144875) has the molecular formula C22H28F3N3O2S and a molecular weight of 455.55 g/mol. Its IUPAC name is 1-(2-ethylcyclopropyl)-N-[3-[[7-(trifluoromethyl)quinolin-4-yl]amino]propyl]but-1-ene-1-sulfonamide.
| Compound Name | 1-(2-ethylcyclopropyl)-N-[3-[[7-(trifluoromethyl)quinolin-4-yl]amino]propyl]but-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 123144875 |
| Molecular Formula | C22H28F3N3O2S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 1-(2-ethylcyclopropyl)-N-[3-[[7-(trifluoromethyl)quinolin-4-yl]amino]propyl]but-1-ene-1-sulfonamide |
| SMILES | CCC=C(C1CC1CC)S(=O)(=O)NCCCNc1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C22H28F3N3O2S/c1-3-6-21(18-13-15(18)4-2)31(29,30)28-11-5-10-26-19-9-12-27-20-14-16(22(23,24)25)7-8-17(19)20/h6-9,12,14-15,18,28H,3-5,10-11,13H2,1-2H3,(H,26,27) |
| InChIKey | GFJHKTFIRPDTHV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|