C8H8 — CID 123146303
3-ethynylhexa-1,3,5-triene (PubChem CID 123146303) has the molecular formula C8H8 and a molecular weight of 104.15 g/mol. Its IUPAC name is 3-ethynylhexa-1,3,5-triene.
| Compound Name | 3-ethynylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 123146303 |
| Molecular Formula | C8H8 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.06 |
| IUPAC Name | 3-ethynylhexa-1,3,5-triene |
| SMILES | C#CC(C=C)=CC=C |
| InChI | InChI=1S/C8H8/c1-4-7-8(5-2)6-3/h2,4,6-7H,1,3H2 |
| InChIKey | RHORGJOJADBERI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|