C15H18N6O2S — CID 123147795
5-[4-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-6-yl)butyl]pyridine-3-sulfonamide (PubChem CID 123147795) has the molecular formula C15H18N6O2S and a molecular weight of 346.42 g/mol. Its IUPAC name is 5-[4-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-6-yl)butyl]pyridine-3-sulfonamide.
| Compound Name | 5-[4-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-6-yl)butyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 123147795 |
| Molecular Formula | C15H18N6O2S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 5-[4-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-6-yl)butyl]pyridine-3-sulfonamide |
| SMILES | Nc1nc2ccc(CCCCc3cncc(S(N)(=O)=O)c3)cn2n1 |
| InChI | InChI=1S/C15H18N6O2S/c16-15-19-14-6-5-11(10-21(14)20-15)3-1-2-4-12-7-13(9-18-8-12)24(17,22)23/h5-10H,1-4H2,(H2,16,20)(H2,17,22,23) |
| InChIKey | RCTBOVFHPDWAPS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|