C12H14N4O — CID 87497204
2-isocyanato-6-pentyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 87497204) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-isocyanato-6-pentyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-isocyanato-6-pentyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 87497204 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-isocyanato-6-pentyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CCCCCc1ccc2nc(N=C=O)nn2c1 |
| InChI | InChI=1S/C12H14N4O/c1-2-3-4-5-10-6-7-11-14-12(13-9-17)15-16(11)8-10/h6-8H,2-5H2,1H3 |
| InChIKey | QDPFGOMBABGWRB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|