C20H25F2NO — CID 123151688
2-butan-2-yl-5-(2-cyclopropylethynyl)-N-(3,3-difluorocyclobutyl)hepta-2,4,6-trienamide (PubChem CID 123151688) has the molecular formula C20H25F2NO and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-butan-2-yl-5-(2-cyclopropylethynyl)-N-(3,3-difluorocyclobutyl)hepta-2,4,6-trienamide.
| Compound Name | 2-butan-2-yl-5-(2-cyclopropylethynyl)-N-(3,3-difluorocyclobutyl)hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 123151688 |
| Molecular Formula | C20H25F2NO |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-butan-2-yl-5-(2-cyclopropylethynyl)-N-(3,3-difluorocyclobutyl)hepta-2,4,6-trienamide |
| SMILES | C=CC(C#CC1CC1)=CC=C(C(=O)NC1CC(F)(F)C1)C(C)CC |
| InChI | InChI=1S/C20H25F2NO/c1-4-14(3)18(19(24)23-17-12-20(21,22)13-17)11-10-15(5-2)6-7-16-8-9-16/h5,10-11,14,16-17H,2,4,8-9,12-13H2,1,3H3,(H,23,24) |
| InChIKey | XGUPYJUYNUUABC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|