C10H13NO — CID 123153489
6,7-di(ethylidene)-4-azaspiro[2.4]heptan-5-one (PubChem CID 123153489) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 6,7-di(ethylidene)-4-azaspiro[2.4]heptan-5-one.
| Compound Name | 6,7-di(ethylidene)-4-azaspiro[2.4]heptan-5-one |
|---|---|
| PubChem CID | 123153489 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 6,7-di(ethylidene)-4-azaspiro[2.4]heptan-5-one |
| SMILES | CC=C1C(=O)NC2(CC2)C1=CC |
| InChI | InChI=1S/C10H13NO/c1-3-7-8(4-2)10(5-6-10)11-9(7)12/h3-4H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | TXCPQKVFTDSFHB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|