C30H41NO — CID 145389342
ethane;(3E,4E)-3-ethylidene-5-[(3E,5Z,7Z)-6-methylnona-1,3,5,7-tetraen-3-yl]-5-[(3E,5Z)-7-methylocta-3,5,7-trien-4-yl]-4-prop-2-enylidenepyrrolidin-2-one (PubChem CID 145389342) has the molecular formula C30H41NO and a molecular weight of 431.66 g/mol. Its IUPAC name is ethane;(3E,4E)-3-ethylidene-5-[(3E,5Z,7Z)-6-methylnona-1,3,5,7-tetraen-3-yl]-5-[(3E,5Z)-7-methylocta-3,5,7-trien-4-yl]-4-prop-2-enylidenepyrrolidin-2-one.
| Compound Name | ethane;(3E,4E)-3-ethylidene-5-[(3E,5Z,7Z)-6-methylnona-1,3,5,7-tetraen-3-yl]-5-[(3E,5Z)-7-methylocta-3,5,7-trien-4-yl]-4-prop-2-enylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 145389342 |
| Molecular Formula | C30H41NO |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | ethane;(3E,4E)-3-ethylidene-5-[(3E,5Z,7Z)-6-methylnona-1,3,5,7-tetraen-3-yl]-5-[(3E,5Z)-7-methylocta-3,5,7-trien-4-yl]-4-prop-2-enylidenepyrrolidin-2-one |
| SMILES | C=C/C=C1C(=C/C)\C(=O)NC\1(/C(C=C)=C/C=C(C)\C=C/C)C(/C=C\C(=C)C)=C/CC.CC |
| InChI | InChI=1S/C28H35NO.C2H6/c1-9-14-22(8)18-20-23(12-4)28(24(15-10-2)19-17-21(6)7)26(16-11-3)25(13-5)27(30)29-28;1-2/h9,11-20H,3-4,6,10H2,1-2,5,7-8H3,(H,29,30);1-2H3/b14-9-,19-17-,22-18-,23-20+,24-15+,25-13+,26-16+; |
| InChIKey | OABKFTCVYIYTJJ-AJKDVDSOSA-N |
| XLogP | 8.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|