C16H14N2O2 — CID 123155875
1-(4-phenyl-2-pyridinyl)piperidine-3,4-dione (PubChem CID 123155875) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-(4-phenyl-2-pyridinyl)piperidine-3,4-dione.
| Compound Name | 1-(4-phenyl-2-pyridinyl)piperidine-3,4-dione |
|---|---|
| PubChem CID | 123155875 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(4-phenyl-2-pyridinyl)piperidine-3,4-dione |
| SMILES | O=C1CCN(c2cc(-c3ccccc3)ccn2)CC1=O |
| InChI | InChI=1S/C16H14N2O2/c19-14-7-9-18(11-15(14)20)16-10-13(6-8-17-16)12-4-2-1-3-5-12/h1-6,8,10H,7,9,11H2 |
| InChIKey | PIYTUYZQHPEDND-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|