C19H30O7 — CID 123159237
(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) 2-ethyl-2,4,4-trimethylpentanoate (PubChem CID 123159237) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) 2-ethyl-2,4,4-trimethylpentanoate.
| Compound Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) 2-ethyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123159237 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl) 2-ethyl-2,4,4-trimethylpentanoate |
| SMILES | CCC(C)(CC(C)(C)C)C(=O)OC1C(=O)OC2C3OC(C)(C)OC3OC12 |
| InChI | InChI=1S/C19H30O7/c1-8-19(7,9-17(2,3)4)16(21)24-12-10-11(22-14(12)20)13-15(23-10)26-18(5,6)25-13/h10-13,15H,8-9H2,1-7H3 |
| InChIKey | NYRFSFYMVJOXCY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |