C18H34 — CID 123159246
3-(3-ethyl-2,5,6-trimethylheptan-4-yl)-1,2-dimethylcyclobutene (PubChem CID 123159246) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 3-(3-ethyl-2,5,6-trimethylheptan-4-yl)-1,2-dimethylcyclobutene.
| Compound Name | 3-(3-ethyl-2,5,6-trimethylheptan-4-yl)-1,2-dimethylcyclobutene |
|---|---|
| PubChem CID | 123159246 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 3-(3-ethyl-2,5,6-trimethylheptan-4-yl)-1,2-dimethylcyclobutene |
| SMILES | CCC(C(C)C)C(C1CC(C)=C1C)C(C)C(C)C |
| InChI | InChI=1S/C18H34/c1-9-16(12(4)5)18(14(7)11(2)3)17-10-13(6)15(17)8/h11-12,14,16-18H,9-10H2,1-8H3 |
| InChIKey | SRIUZSIHWVKNOS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|