C23H42 — CID 123162551
8-butan-2-yl-2,4,5,6,7,13-hexamethyltricyclo[7.2.2.04,10]tridecane (PubChem CID 123162551) has the molecular formula C23H42 and a molecular weight of 318.59 g/mol. Its IUPAC name is 8-butan-2-yl-2,4,5,6,7,13-hexamethyltricyclo[7.2.2.04,10]tridecane.
| Compound Name | 8-butan-2-yl-2,4,5,6,7,13-hexamethyltricyclo[7.2.2.04,10]tridecane |
|---|---|
| PubChem CID | 123162551 |
| Molecular Formula | C23H42 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 318.33 |
| IUPAC Name | 8-butan-2-yl-2,4,5,6,7,13-hexamethyltricyclo[7.2.2.04,10]tridecane |
| SMILES | CCC(C)C1C(C)C(C)C(C)C2(C)CC(C)C3CC(C)C1C2C3 |
| InChI | InChI=1S/C23H42/c1-9-13(2)21-17(6)16(5)18(7)23(8)12-15(4)19-10-14(3)22(21)20(23)11-19/h13-22H,9-12H2,1-8H3 |
| InChIKey | SZALWOXFTRRCBJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |