C27H51NO8 — CID 123178551
octadec-9-enyl (2S)-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propanoate (PubChem CID 123178551) has the molecular formula C27H51NO8 and a molecular weight of 517.70 g/mol. Its IUPAC name is octadec-9-enyl (2S)-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propanoate.
| Compound Name | octadec-9-enyl (2S)-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 123178551 |
| Molecular Formula | C27H51NO8 |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.36 |
| IUPAC Name | octadec-9-enyl (2S)-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propanoate |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(=O)[C@H](C)NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C27H51NO8/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-36-27(35)21(2)28-26(34)25(33)24(32)23(31)22(30)20-29/h10-11,21-25,29-33H,3-9,12-20H2,1-2H3,(H,28,34)/t21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | TVJGMAPFDPAZTK-VCDBXAJLSA-N |
| XLogP | 2.51 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|