C13H16S — CID 123179453
3,3a-dimethyl-2-prop-2-enyl-4H-1-benzothiophene (PubChem CID 123179453) has the molecular formula C13H16S and a molecular weight of 204.34 g/mol. Its IUPAC name is 3,3a-dimethyl-2-prop-2-enyl-4H-1-benzothiophene.
| Compound Name | 3,3a-dimethyl-2-prop-2-enyl-4H-1-benzothiophene |
|---|---|
| PubChem CID | 123179453 |
| Molecular Formula | C13H16S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3,3a-dimethyl-2-prop-2-enyl-4H-1-benzothiophene |
| SMILES | C=CCC1=C(C)C2(C)CC=CC=C2S1 |
| InChI | InChI=1S/C13H16S/c1-4-7-11-10(2)13(3)9-6-5-8-12(13)14-11/h4-6,8H,1,7,9H2,2-3H3 |
| InChIKey | RENZEMVEZCCMCJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|