C18H30S — CID 91110333
2-(2-methylbutan-2-yl)-6-(3-methylhept-5-en-3-yl)-4H-thiopyran (PubChem CID 91110333) has the molecular formula C18H30S and a molecular weight of 278.50 g/mol. Its IUPAC name is 2-(2-methylbutan-2-yl)-6-(3-methylhept-5-en-3-yl)-4H-thiopyran.
| Compound Name | 2-(2-methylbutan-2-yl)-6-(3-methylhept-5-en-3-yl)-4H-thiopyran |
|---|---|
| PubChem CID | 91110333 |
| Molecular Formula | C18H30S |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-(2-methylbutan-2-yl)-6-(3-methylhept-5-en-3-yl)-4H-thiopyran |
| SMILES | CC=CCC(C)(CC)C1=CCC=C(C(C)(C)CC)S1 |
| InChI | InChI=1S/C18H30S/c1-7-10-14-18(6,9-3)16-13-11-12-15(19-16)17(4,5)8-2/h7,10,12-13H,8-9,11,14H2,1-6H3 |
| InChIKey | USMWCRVGPMXQCG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|