C10H16S — CID 91065986
4-ethyl-2,4,6-trimethylthiopyran (PubChem CID 91065986) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is 4-ethyl-2,4,6-trimethylthiopyran.
| Compound Name | 4-ethyl-2,4,6-trimethylthiopyran |
|---|---|
| PubChem CID | 91065986 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-ethyl-2,4,6-trimethylthiopyran |
| SMILES | CCC1(C)C=C(C)SC(C)=C1 |
| InChI | InChI=1S/C10H16S/c1-5-10(4)6-8(2)11-9(3)7-10/h6-7H,5H2,1-4H3 |
| InChIKey | QQBFRFNELMVLJT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |