C12H16S2 — CID 58245006
6-tert-butyl-3a,7a-dihydro-3H-1-benzothiophene-2-thione (PubChem CID 58245006) has the molecular formula C12H16S2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 6-tert-butyl-3a,7a-dihydro-3H-1-benzothiophene-2-thione.
| Compound Name | 6-tert-butyl-3a,7a-dihydro-3H-1-benzothiophene-2-thione |
|---|---|
| PubChem CID | 58245006 |
| Molecular Formula | C12H16S2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 6-tert-butyl-3a,7a-dihydro-3H-1-benzothiophene-2-thione |
| SMILES | CC(C)(C)C1=CC2SC(=S)CC2C=C1 |
| InChI | InChI=1S/C12H16S2/c1-12(2,3)9-5-4-8-6-11(13)14-10(8)7-9/h4-5,7-8,10H,6H2,1-3H3 |
| InChIKey | OUYBDAJFCJFNEK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|