C12H21N7 — CID 123180509
6-methyl-2-(3-piperidin-4-yl-1H-1,2,4-triazol-5-yl)-1,2,3,6-tetrahydropyrazin-5-amine (PubChem CID 123180509) has the molecular formula C12H21N7 and a molecular weight of 263.35 g/mol. Its IUPAC name is 6-methyl-2-(3-piperidin-4-yl-1H-1,2,4-triazol-5-yl)-1,2,3,6-tetrahydropyrazin-5-amine.
| Compound Name | 6-methyl-2-(3-piperidin-4-yl-1H-1,2,4-triazol-5-yl)-1,2,3,6-tetrahydropyrazin-5-amine |
|---|---|
| PubChem CID | 123180509 |
| Molecular Formula | C12H21N7 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 6-methyl-2-(3-piperidin-4-yl-1H-1,2,4-triazol-5-yl)-1,2,3,6-tetrahydropyrazin-5-amine |
| SMILES | CC1NC(c2nc(C3CCNCC3)n[nH]2)CN=C1N |
| InChI | InChI=1S/C12H21N7/c1-7-10(13)15-6-9(16-7)12-17-11(18-19-12)8-2-4-14-5-3-8/h7-9,14,16H,2-6H2,1H3,(H2,13,15)(H,17,18,19) |
| InChIKey | YJOPSDPPMWTMLF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |