C27H34N4O2S — CID 123187811
2-[[6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohex-3-en-1-yl]methyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 123187811) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is 2-[[6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohex-3-en-1-yl]methyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[[6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohex-3-en-1-yl]methyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 123187811 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 2-[[6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohex-3-en-1-yl]methyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CC1CC=CCC1CN1CCN(c3nsc4ccccc34)CC1)CCCC2 |
| InChI | InChI=1S/C27H34N4O2S/c32-26-21-9-3-4-10-22(21)27(33)31(26)18-20-8-2-1-7-19(20)17-29-13-15-30(16-14-29)25-23-11-5-6-12-24(23)34-28-25/h1-2,5-6,11-12,19-20,32-33H,3-4,7-10,13-18H2 |
| InChIKey | VVSJNQXUZXLEQF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 64.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|