C16H17F3N2O2 — CID 123188568
[3-methyl-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylidene-N'-(2-methylprop-1-enyl)carbamimidate (PubChem CID 123188568) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is [3-methyl-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylidene-N'-(2-methylprop-1-enyl)carbamimidate.
| Compound Name | [3-methyl-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylidene-N'-(2-methylprop-1-enyl)carbamimidate |
|---|---|
| PubChem CID | 123188568 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [3-methyl-3-(trifluoromethyl)-1H-2-benzofuran-5-yl] N-methylidene-N'-(2-methylprop-1-enyl)carbamimidate |
| SMILES | C=N/C(=N\C=C(C)C)Oc1ccc2c(c1)C(C)(C(F)(F)F)OC2 |
| InChI | InChI=1S/C16H17F3N2O2/c1-10(2)8-21-14(20-4)23-12-6-5-11-9-22-15(3,13(11)7-12)16(17,18)19/h5-8H,4,9H2,1-3H3/b21-14+ |
| InChIKey | OAWKQHGDIHAXEO-KGENOOAVSA-N |
| XLogP | 4.35 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|