C16H18N4O4 — CID 155196034
(3-methoxyphenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate (PubChem CID 155196034) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is (3-methoxyphenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate.
| Compound Name | (3-methoxyphenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate |
|---|---|
| PubChem CID | 155196034 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (3-methoxyphenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate |
| SMILES | C=N/C(=N\C=C(/C)N1CCC(=O)NC1=O)Oc1cccc(OC)c1 |
| InChI | InChI=1S/C16H18N4O4/c1-11(20-8-7-14(21)19-16(20)22)10-18-15(17-2)24-13-6-4-5-12(9-13)23-3/h4-6,9-10H,2,7-8H2,1,3H3,(H,19,21,22)/b11-10+,18-15+ |
| InChIKey | DPPKIDBAAVAKBW-LNCIWOMLSA-N |
| XLogP | 1.93 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|