C17H20N4O3 — CID 170263282
(3,5-dimethylphenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate (PubChem CID 170263282) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (3,5-dimethylphenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate.
| Compound Name | (3,5-dimethylphenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate |
|---|---|
| PubChem CID | 170263282 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3,5-dimethylphenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate |
| SMILES | C=N/C(=N\C=C(/C)N1CCC(=O)NC1=O)Oc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C17H20N4O3/c1-11-7-12(2)9-14(8-11)24-16(18-4)19-10-13(3)21-6-5-15(22)20-17(21)23/h7-10H,4-6H2,1-3H3,(H,20,22,23)/b13-10+,19-16+ |
| InChIKey | HXZXVNVHHSLUSV-CUZICJGVSA-N |
| XLogP | 2.54 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|