C29H42O5S — CID 123189339
[(2S)-2-[(7aR)-4-[2-[(3S)-3-hydroxy-1-bicyclo[3.1.0]hexanyl]-2-methoxyethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 4-methylbenzenesulfonate (PubChem CID 123189339) has the molecular formula C29H42O5S and a molecular weight of 502.72 g/mol. Its IUPAC name is [(2S)-2-[(7aR)-4-[2-[(3S)-3-hydroxy-1-bicyclo[3.1.0]hexanyl]-2-methoxyethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[(7aR)-4-[2-[(3S)-3-hydroxy-1-bicyclo[3.1.0]hexanyl]-2-methoxyethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 123189339 |
| Molecular Formula | C29H42O5S |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | [(2S)-2-[(7aR)-4-[2-[(3S)-3-hydroxy-1-bicyclo[3.1.0]hexanyl]-2-methoxyethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl] 4-methylbenzenesulfonate |
| SMILES | COC(C=C1CCC[C@@]2(C)C1CCC2[C@H](C)COS(=O)(=O)c1ccc(C)cc1)C12CC1C[C@H](O)C2 |
| InChI | InChI=1S/C29H42O5S/c1-19-7-9-24(10-8-19)35(31,32)34-18-20(2)25-11-12-26-21(6-5-13-28(25,26)3)14-27(33-4)29-16-22(29)15-23(30)17-29/h7-10,14,20,22-23,25-27,30H,5-6,11-13,15-18H2,1-4H3/t20-,22?,23+,25?,26?,27?,28-,29?/m1/s1 |
| InChIKey | ISFSNNKOSCWCCB-HUMBKUDSSA-N |
| XLogP | 5.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|