C26H38N3O7P — CID 123199915
methyl 2-[[3-[2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]cyclopentyl]butoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 123199915) has the molecular formula C26H38N3O7P and a molecular weight of 535.58 g/mol. Its IUPAC name is methyl 2-[[3-[2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]cyclopentyl]butoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[3-[2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]cyclopentyl]butoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123199915 |
| Molecular Formula | C26H38N3O7P |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | methyl 2-[[3-[2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]cyclopentyl]butoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(OCCC(C)C1CCCC1CCn1cc(C)c(=O)[nH]c1=O)Oc1ccccc1 |
| InChI | InChI=1S/C26H38N3O7P/c1-18(23-12-8-9-21(23)13-15-29-17-19(2)24(30)27-26(29)32)14-16-35-37(33,28-20(3)25(31)34-4)36-22-10-6-5-7-11-22/h5-7,10-11,17-18,20-21,23H,8-9,12-16H2,1-4H3,(H,28,33)(H,27,30,32) |
| InChIKey | KUVGFJUMIIYZTQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|