C12H11ClF2N2O2 — CID 123207788
4-[3-(6-chloro-3-pyridinyl)-1,1-difluoropropan-2-yl]iminooxolan-2-one (PubChem CID 123207788) has the molecular formula C12H11ClF2N2O2 and a molecular weight of 288.68 g/mol. Its IUPAC name is 4-[3-(6-chloro-3-pyridinyl)-1,1-difluoropropan-2-yl]iminooxolan-2-one.
| Compound Name | 4-[3-(6-chloro-3-pyridinyl)-1,1-difluoropropan-2-yl]iminooxolan-2-one |
|---|---|
| PubChem CID | 123207788 |
| Molecular Formula | C12H11ClF2N2O2 |
| Molecular Weight | 288.68 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-[3-(6-chloro-3-pyridinyl)-1,1-difluoropropan-2-yl]iminooxolan-2-one |
| SMILES | O=C1C/C(=N/C(Cc2ccc(Cl)nc2)C(F)F)CO1 |
| InChI | InChI=1S/C12H11ClF2N2O2/c13-10-2-1-7(5-16-10)3-9(12(14)15)17-8-4-11(18)19-6-8/h1-2,5,9,12H,3-4,6H2/b17-8- |
| InChIKey | CCRBCIIYDJCBFW-IUXPMGMMSA-N |
| XLogP | 2.30 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.68 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|