C15H16ClF2NO2 — CID 149224711
3-[3-[(6-chloro-3-pyridinyl)methyl]-5,5-difluoropentyl]-2H-furan-5-one (PubChem CID 149224711) has the molecular formula C15H16ClF2NO2 and a molecular weight of 315.75 g/mol. Its IUPAC name is 3-[3-[(6-chloro-3-pyridinyl)methyl]-5,5-difluoropentyl]-2H-furan-5-one.
| Compound Name | 3-[3-[(6-chloro-3-pyridinyl)methyl]-5,5-difluoropentyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 149224711 |
| Molecular Formula | C15H16ClF2NO2 |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-[3-[(6-chloro-3-pyridinyl)methyl]-5,5-difluoropentyl]-2H-furan-5-one |
| SMILES | O=C1C=C(CCC(Cc2ccc(Cl)nc2)CC(F)F)CO1 |
| InChI | InChI=1S/C15H16ClF2NO2/c16-13-4-3-11(8-19-13)5-10(6-14(17)18)1-2-12-7-15(20)21-9-12/h3-4,7-8,10,14H,1-2,5-6,9H2 |
| InChIKey | XJCZNWNYWJRABK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|