C25H29N3O7 — CID 123212526
[4-[3-methoxy-2-[(2-methoxy-2-oxoacetyl)amino]-3-oxopropyl]phenyl] 3-(piperazin-1-ylmethyl)benzoate (PubChem CID 123212526) has the molecular formula C25H29N3O7 and a molecular weight of 483.52 g/mol. Its IUPAC name is [4-[3-methoxy-2-[(2-methoxy-2-oxoacetyl)amino]-3-oxopropyl]phenyl] 3-(piperazin-1-ylmethyl)benzoate.
| Compound Name | [4-[3-methoxy-2-[(2-methoxy-2-oxoacetyl)amino]-3-oxopropyl]phenyl] 3-(piperazin-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 123212526 |
| Molecular Formula | C25H29N3O7 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | [4-[3-methoxy-2-[(2-methoxy-2-oxoacetyl)amino]-3-oxopropyl]phenyl] 3-(piperazin-1-ylmethyl)benzoate |
| SMILES | COC(=O)C(=O)NC(Cc1ccc(OC(=O)c2cccc(CN3CCNCC3)c2)cc1)C(=O)OC |
| InChI | InChI=1S/C25H29N3O7/c1-33-24(31)21(27-22(29)25(32)34-2)15-17-6-8-20(9-7-17)35-23(30)19-5-3-4-18(14-19)16-28-12-10-26-11-13-28/h3-9,14,21,26H,10-13,15-16H2,1-2H3,(H,27,29) |
| InChIKey | VSXXAXACMFGIDJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|