C13H27NO9Si — CID 123214686
(3,4,5-trihydroxy-2-oxopentyl) N-(triethoxysilylmethyl)carbamate (PubChem CID 123214686) has the molecular formula C13H27NO9Si and a molecular weight of 369.44 g/mol. Its IUPAC name is (3,4,5-trihydroxy-2-oxopentyl) N-(triethoxysilylmethyl)carbamate.
| Compound Name | (3,4,5-trihydroxy-2-oxopentyl) N-(triethoxysilylmethyl)carbamate |
|---|---|
| PubChem CID | 123214686 |
| Molecular Formula | C13H27NO9Si |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (3,4,5-trihydroxy-2-oxopentyl) N-(triethoxysilylmethyl)carbamate |
| SMILES | CCO[Si](CNC(=O)OCC(=O)C(O)C(O)CO)(OCC)OCC |
| InChI | InChI=1S/C13H27NO9Si/c1-4-21-24(22-5-2,23-6-3)9-14-13(19)20-8-11(17)12(18)10(16)7-15/h10,12,15-16,18H,4-9H2,1-3H3,(H,14,19) |
| InChIKey | MWSWTVVNZPCFJK-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|