C24H46 — CID 123222087
3,4,5,7,8,10-hexamethyl-6-(3-methylbutan-2-yl)-9-methylidenedodec-4-ene (PubChem CID 123222087) has the molecular formula C24H46 and a molecular weight of 334.63 g/mol. Its IUPAC name is 3,4,5,7,8,10-hexamethyl-6-(3-methylbutan-2-yl)-9-methylidenedodec-4-ene.
| Compound Name | 3,4,5,7,8,10-hexamethyl-6-(3-methylbutan-2-yl)-9-methylidenedodec-4-ene |
|---|---|
| PubChem CID | 123222087 |
| Molecular Formula | C24H46 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 334.36 |
| IUPAC Name | 3,4,5,7,8,10-hexamethyl-6-(3-methylbutan-2-yl)-9-methylidenedodec-4-ene |
| SMILES | C=C(C(C)CC)C(C)C(C)C(C(C)=C(C)C(C)CC)C(C)C(C)C |
| InChI | InChI=1S/C24H46/c1-13-16(5)19(8)21(10)23(12)24(18(7)15(3)4)22(11)20(9)17(6)14-2/h15-18,21,23-24H,8,13-14H2,1-7,9-12H3 |
| InChIKey | OTJGLBZQJFZVKK-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|