C15H10F3N3 — CID 123222423
4-[2-(2,3,5-trifluorophenyl)-3-pyridinyl]-2,5-dihydropyrimidine (PubChem CID 123222423) has the molecular formula C15H10F3N3 and a molecular weight of 289.26 g/mol. Its IUPAC name is 4-[2-(2,3,5-trifluorophenyl)-3-pyridinyl]-2,5-dihydropyrimidine.
| Compound Name | 4-[2-(2,3,5-trifluorophenyl)-3-pyridinyl]-2,5-dihydropyrimidine |
|---|---|
| PubChem CID | 123222423 |
| Molecular Formula | C15H10F3N3 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-[2-(2,3,5-trifluorophenyl)-3-pyridinyl]-2,5-dihydropyrimidine |
| SMILES | Fc1cc(F)c(F)c(-c2ncccc2C2=NCN=CC2)c1 |
| InChI | InChI=1S/C15H10F3N3/c16-9-6-11(14(18)12(17)7-9)15-10(2-1-4-20-15)13-3-5-19-8-21-13/h1-2,4-7H,3,8H2 |
| InChIKey | REAWANGODMXKLX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|