C14H7F3N2 — CID 175737885
8-(2,3,5-trifluorophenyl)cinnoline (PubChem CID 175737885) has the molecular formula C14H7F3N2 and a molecular weight of 260.22 g/mol. Its IUPAC name is 8-(2,3,5-trifluorophenyl)cinnoline.
| Compound Name | 8-(2,3,5-trifluorophenyl)cinnoline |
|---|---|
| PubChem CID | 175737885 |
| Molecular Formula | C14H7F3N2 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 8-(2,3,5-trifluorophenyl)cinnoline |
| SMILES | Fc1cc(F)c(F)c(-c2cccc3ccnnc23)c1 |
| InChI | InChI=1S/C14H7F3N2/c15-9-6-11(13(17)12(16)7-9)10-3-1-2-8-4-5-18-19-14(8)10/h1-7H |
| InChIKey | QOPWPAAMAVJQOZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|